Chemistry
Favorites|Homepage
Subscriptions | sitemap
HOME > Chemistry > Chemistry

Chemistry

There are _______ mol of carbon atoms in 4 mole of dimenthylsulfoxide (C2H6SO)

In the given molecule there are 2 carbon atoms.If there are 4mol of the given molecule,then there will carbon atoms twice as that amount.So the answer is 8mol.

What is the toxicity level of Bromine

What is the toxicity level of bromine?-concentrations of 12,000 ppm caused immediate eye irritation in volunteers and 5 minutes at 6,500 ppm resulted in eye irritation, headache, and vertigo [Sayers a

An atom of a sodium has 11 proton, 11 electrons,12 neutrons. what is it atomic number? What is it mass number

please explain-the atomic number of an element is the number of protons in the neucleus. This is what defines the element.eg, If there are 6 protons then the element is carbon. If there are 7 protons

What makes water boil

what causes it to boil why does water bubble when it gets to a certain temperature.-Air molecules exert pressureon the surface of the water molecules, this reduces the momentum of the atoms within the

IUPAC name for CH3(CH2)2CH(CH2CH3)CH(CH3)(CH2)2CH3

Please help! I got 4-ethyl-5-methyloctane but this doesnt seem right-Well, did you draw it out? Wait, that doesnt even quite make sense. I cant follow how the structure goes. Have another look at you

AP Chemistry Question?!

phosphorus reacts with oxygen to produce different types of oxides. one of these oxides is formed when 1.347 g of p reacts with 1.744 g of o. what is the simplest formula of this oxide? name the oxide

What is the weird "u" symbol in chemistry

It looks just like a lower case u only the left side hangs down more. It is used in the following way in a chemistry problem: According to air quality standards for carbon monoxide in the u.s., the ma

Mole Calculations Help Please

How many moles of chlorine atoms are present in a 9.2 x 10 ^ -2 gsample of zirconium(IV) chloride, ZrCl subscript 4? Please step by step explanationsand answers please please thank you so much -1 mol

Double replacement help

Potassium Bromide + Lead II Nitrate I know its PbBr2 + KNO3 but how do you set up the the original compounds and do double replacement?-In the reactant side of the equation you will need to turn the

How do you draw a model of a homogenous mixture of H2 and He molecules

ok, H2 = brown ms, He = blue ms mix them together so that the brown and blue colors are distributed throughout the container without having one of the colors concentrated in one or more areas. its th

Freezing point equation. 10 points

How do you show that this equation: Molar Mass = (Kf * mass of solute(g) ) / ( mass of solvent(kg) * delta T) results from this equation: delta T = Kf * m * i I cant seem to put stuff together. A

Determine the pH of these solutions

A) [H+] = 1 * 10^-6M B) [H+] = 0.00010M C) [OH-] = 1 * 10^-2M D) [OH-] = 1 * 10^-11M Thanks!-These are all pretty easy.pH = -log[H^+] Put the value for the [H^+] in your calculator and press the log

What is the difference between a phenyl ring and a benzene ring

From what Ive seen they look pretty similar, so whats the difference? Am I correct in saying that a phenyl is the same as a benzene where one of the Hs has been replaced with another functional group?

How many atoms of copper (cu) are in a pure copper coin weighing 12.0g

This requires a two-step conversion. We must first use the molar mass of copper to convert the given grams to moles. Then we can use Avogadros # (6.022 x 10^23) to convert the moles to individual atom

(b) How many moles of ammonium ions are in 0.417 g of ammonium carbonate

The formula of am. carbonate is (NH4)2 CO3 and its molar mass = 96 Moles of am carbonate in 0.417 g= (0.417) / 96 = 0.00434 moles. Each mole of am. carbonate has 2 moles of ammonium ions No. of moles
New
Hot
© 2008-2010 http://www.science-mathematics.com . Program by zplan cms. Theme by wukong .