Chemistry

Really hard Chemistry question that I need help with. Any assistance would be really helpful.

When 0.5963g of a sample containing NaNO2 and some inert material is allowed to react with excess HSO3NH2, the volume of N2 gas produced is measured. The volume of N2 gas corrected to 298.15K and 100k

N2(g) + 3H2(g) -> 2NH3(g)

My friend needs help on this. Weve tried everything and everyone she asks doesnt know. Can someone help? 6.0 mol of N2 are mixed with 12.0 mol of H2 according to the following equation: N2(g) + 3H2(g

CHEMISTRY GAS LAWS HELP!

In a deep sea station used for scientific observation, pressure is maintained at 20.0 atm. If you were to fill the station with 5.5x10^5 L air that was originally at STP, what would be the volume of t

What are the reducing and oxidizing agents in these equations

a)Ca(s) + Cl2(g) -> CaCl2(s) b) Cl2(g) + H2S(g) -> HCl(g) + S(s) c) Ba(NO3)2(aq) + Na2SO4(aq) -> BaSO4(s) + 2NaNO3(aq) d) CH4(g) + 2O2(g) -> CO2(g) + 2H2O(l) e) Ca(OH)2(aq) + CO2(g) -> CaCO3(s) +

Help with quick chemistry questions

Name the following three compounds according to the IUPAC system: 1. CH3-CHCH3-CHCH3-CH2-CH2-CH2-CH3 2. CH3-CH2-C(CH3)2-CH2-CHCH3-CH2-CH3 3. CH3-CH2-C(CH3)2-CHCH3-CH2-CH2-CH3 Im not sure how to do

How do you balance chemical formulas!

im SOOOO CONFUSED!!! Could u plz explain itthen help me with these? 1. Na+MgF2 -- NaF + Mg 2. Mg + HCl -- MgCl2 3. Cl2 + Kl -- KCl + I2 4. NaCl --Na +Cl2 5. Na + O2 -- Na2O 6. Na + HCl -- H2 + NaCl 7.

Help writing chemical formulas

In our science class were having to write chemical formulas, such as aluminum sulfate, lithium oxide, sodium carbonate, magnesium phosphate..etc etc.....i have no idea how to do this. please help easy

Do solids diffuse with each other??? Explain why

Chapter - Matter In Our Surrounding-No they do not diffuse. An inherit characteristic of solids is that their molecules are tightly packed together giving it a fixed shape. For this very reason, solid

Calculate the average of three density measurements of water

Graduated cylinder, adding increments of 10 mL of water to total 30 mL. 1. You have taken measurements of three volumes of water. Record the following masses for each of the three measurements (in gr

When C-12 decays to C-14, does it emit alpha, beta, or gamma radiation

C-12 is stable.It does not decay to C-14. C-14 is radioactive, and decays to N-14, emitting beta radiation.

CHEMISTRY QUESTION! REDOX REACTIONS! PLEASE HELP ME NOW :C

85. Given the balanced equation representing a reaction: 2KClO3(s) --> 2KCl(s) + 3O2(g) The oxidation state of chlorine in this reaction changes from a. -1 to +1 c. +1 to -1 b. -1 to +5 d. +5 to -1

People sprinkle water in open grounds and roof top, why

Chapter - Matter In Our Surrounding-the water that is sprinkled on the ground or roof tops evaporates and the heat needed to evaporate is taken up from the surface, thus producing a cooling effect-may

At equilibrium, what is true about the concentrations of reactants and products

Draw a graph that shows this relationship.-At equilibrium, the concentration of products and reactant.s is not changing. Straight line-At equillibrium, theconcentration of reactants is equal to the co

What would happen if i added oxygen into my pencil torch.

Ok I know its probably a bad idea, but my friend and I were talking and got to wondering if we filled the torch with a little oxygen on top of the butane what would the results be? im thinking no flam

Chem Masters..help please! What pressure will a mixture..

10 points for best answer and I will love you forever and EVER! What pressure will a mixture of 1.25 mole of methane, CH4, and 0.575 mole of propane, C3H8, exert with a volume of 13.0 L at 50 degrees